C27H27N3O — CID 102120697
3-methyl-4-[3-phenyl-3-(4-phenylpiperazin-1-yl)prop-1-ynyl]benzamide (PubChem CID 102120697) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-methyl-4-[3-phenyl-3-(4-phenylpiperazin-1-yl)prop-1-ynyl]benzamide.
| Compound Name | 3-methyl-4-[3-phenyl-3-(4-phenylpiperazin-1-yl)prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 102120697 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 3-methyl-4-[3-phenyl-3-(4-phenylpiperazin-1-yl)prop-1-ynyl]benzamide |
| SMILES | Cc1cc(C(N)=O)ccc1C#CC(c1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H27N3O/c1-21-20-24(27(28)31)13-12-22(21)14-15-26(23-8-4-2-5-9-23)30-18-16-29(17-19-30)25-10-6-3-7-11-25/h2-13,20,26H,16-19H2,1H3,(H2,28,31) |
| InChIKey | RAANPPKKVMWMKB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|