C22H25ClN2O8 — CID 160873696
1-[chloro(phenyl)methyl]-4-(3-methylphenyl)piperazine;oxalic acid (PubChem CID 160873696) has the molecular formula C22H25ClN2O8 and a molecular weight of 480.90 g/mol. Its IUPAC name is 1-[chloro(phenyl)methyl]-4-(3-methylphenyl)piperazine;oxalic acid.
| Compound Name | 1-[chloro(phenyl)methyl]-4-(3-methylphenyl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 160873696 |
| Molecular Formula | C22H25ClN2O8 |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 1-[chloro(phenyl)methyl]-4-(3-methylphenyl)piperazine;oxalic acid |
| SMILES | Cc1cccc(N2CCN(C(Cl)c3ccccc3)CC2)c1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H21ClN2.2C2H2O4/c1-15-6-5-9-17(14-15)20-10-12-21(13-11-20)18(19)16-7-3-2-4-8-16;2*3-1(4)2(5)6/h2-9,14,18H,10-13H2,1H3;2*(H,3,4)(H,5,6) |
| InChIKey | SMCFZPXDRFDLPS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|