C21H30N2O — CID 160837430
methane;2-[4-(3-methylphenyl)piperazin-1-yl]-1-phenylpropan-1-ol (PubChem CID 160837430) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is methane;2-[4-(3-methylphenyl)piperazin-1-yl]-1-phenylpropan-1-ol.
| Compound Name | methane;2-[4-(3-methylphenyl)piperazin-1-yl]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 160837430 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | methane;2-[4-(3-methylphenyl)piperazin-1-yl]-1-phenylpropan-1-ol |
| SMILES | C.Cc1cccc(N2CCN(C(C)C(O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H26N2O.CH4/c1-16-7-6-10-19(15-16)22-13-11-21(12-14-22)17(2)20(23)18-8-4-3-5-9-18;/h3-10,15,17,20,23H,11-14H2,1-2H3;1H4 |
| InChIKey | SHOWWTRMVGKLQG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |