C23H23N5 — CID 68871969
5-amino-2-[4-[phenyl(pyridin-3-yl)methyl]piperazin-1-yl]benzonitrile (PubChem CID 68871969) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is 5-amino-2-[4-[phenyl(pyridin-3-yl)methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 5-amino-2-[4-[phenyl(pyridin-3-yl)methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 68871969 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 5-amino-2-[4-[phenyl(pyridin-3-yl)methyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1cc(N)ccc1N1CCN(C(c2ccccc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C23H23N5/c24-16-20-15-21(25)8-9-22(20)27-11-13-28(14-12-27)23(18-5-2-1-3-6-18)19-7-4-10-26-17-19/h1-10,15,17,23H,11-14,25H2 |
| InChIKey | LASSYBJWSKFDHI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|