C23H26N4 — CID 54794978
4-(4-benzhydrylpiperazin-1-yl)benzene-1,3-diamine (PubChem CID 54794978) has the molecular formula C23H26N4 and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-1-yl)benzene-1,3-diamine.
| Compound Name | 4-(4-benzhydrylpiperazin-1-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 54794978 |
| Molecular Formula | C23H26N4 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-1-yl)benzene-1,3-diamine |
| SMILES | Nc1ccc(N2CCN(C(c3ccccc3)c3ccccc3)CC2)c(N)c1 |
| InChI | InChI=1S/C23H26N4/c24-20-11-12-22(21(25)17-20)26-13-15-27(16-14-26)23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,17,23H,13-16,24-25H2 |
| InChIKey | NJRRYYCTJXJRQN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|