C28H32N4O — CID 100652215
[5-amino-2-(4-benzhydrylpiperazin-1-yl)phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 100652215) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is [5-amino-2-(4-benzhydrylpiperazin-1-yl)phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-amino-2-(4-benzhydrylpiperazin-1-yl)phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 100652215 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [5-amino-2-(4-benzhydrylpiperazin-1-yl)phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | Nc1ccc(N2CCN(C(c3ccccc3)c3ccccc3)CC2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C28H32N4O/c29-24-13-14-26(25(21-24)28(33)32-15-7-8-16-32)30-17-19-31(20-18-30)27(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-6,9-14,21,27H,7-8,15-20,29H2 |
| InChIKey | FDBNXUOWZTUSKM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|