C24H28N4O2 — CID 171797770
(5-amino-3-pyridinyl)-(4-benzhydrylpiperazin-1-yl)methanone;methanol (PubChem CID 171797770) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (5-amino-3-pyridinyl)-(4-benzhydrylpiperazin-1-yl)methanone;methanol.
| Compound Name | (5-amino-3-pyridinyl)-(4-benzhydrylpiperazin-1-yl)methanone;methanol |
|---|---|
| PubChem CID | 171797770 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (5-amino-3-pyridinyl)-(4-benzhydrylpiperazin-1-yl)methanone;methanol |
| SMILES | CO.Nc1cncc(C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H24N4O.CH4O/c24-21-15-20(16-25-17-21)23(28)27-13-11-26(12-14-27)22(18-7-3-1-4-8-18)19-9-5-2-6-10-19;1-2/h1-10,15-17,22H,11-14,24H2;2H,1H3 |
| InChIKey | BNCXIGNAHABRCR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |