C24H22FN5O — CID 171797581
3-[(S)-[4-(5-aminopyridine-3-carbonyl)piperazin-1-yl]-phenylmethyl]-4-fluorobenzonitrile (PubChem CID 171797581) has the molecular formula C24H22FN5O and a molecular weight of 415.47 g/mol. Its IUPAC name is 3-[(S)-[4-(5-aminopyridine-3-carbonyl)piperazin-1-yl]-phenylmethyl]-4-fluorobenzonitrile.
| Compound Name | 3-[(S)-[4-(5-aminopyridine-3-carbonyl)piperazin-1-yl]-phenylmethyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 171797581 |
| Molecular Formula | C24H22FN5O |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-[(S)-[4-(5-aminopyridine-3-carbonyl)piperazin-1-yl]-phenylmethyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c([C@H](c2ccccc2)N2CCN(C(=O)c3cncc(N)c3)CC2)c1 |
| InChI | InChI=1S/C24H22FN5O/c25-22-7-6-17(14-26)12-21(22)23(18-4-2-1-3-5-18)29-8-10-30(11-9-29)24(31)19-13-20(27)16-28-15-19/h1-7,12-13,15-16,23H,8-11,27H2/t23-/m0/s1 |
| InChIKey | BTVRPHBVUBOKLT-QHCPKHFHSA-N |
| XLogP | 3.22 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |