C25H25F2N5O — CID 171797725
(5-amino-3-pyridinyl)-[3-(difluoromethyl)piperazin-1-yl]methanone;3-benzylbenzonitrile (PubChem CID 171797725) has the molecular formula C25H25F2N5O and a molecular weight of 449.51 g/mol. Its IUPAC name is (5-amino-3-pyridinyl)-[3-(difluoromethyl)piperazin-1-yl]methanone;3-benzylbenzonitrile.
| Compound Name | (5-amino-3-pyridinyl)-[3-(difluoromethyl)piperazin-1-yl]methanone;3-benzylbenzonitrile |
|---|---|
| PubChem CID | 171797725 |
| Molecular Formula | C25H25F2N5O |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (5-amino-3-pyridinyl)-[3-(difluoromethyl)piperazin-1-yl]methanone;3-benzylbenzonitrile |
| SMILES | N#Cc1cccc(Cc2ccccc2)c1.Nc1cncc(C(=O)N2CCNC(C(F)F)C2)c1 |
| InChI | InChI=1S/C14H11N.C11H14F2N4O/c15-11-14-8-4-7-13(10-14)9-12-5-2-1-3-6-12;12-10(13)9-6-17(2-1-16-9)11(18)7-3-8(14)5-15-4-7/h1-8,10H,9H2;3-5,9-10,16H,1-2,6,14H2 |
| InChIKey | RXMNIFWCNCKXPJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |