C14H19N3 — CID 55155544
5-amino-2-(4,4-dimethylpiperidin-1-yl)benzonitrile (PubChem CID 55155544) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 5-amino-2-(4,4-dimethylpiperidin-1-yl)benzonitrile.
| Compound Name | 5-amino-2-(4,4-dimethylpiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 55155544 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 5-amino-2-(4,4-dimethylpiperidin-1-yl)benzonitrile |
| SMILES | CC1(C)CCN(c2ccc(N)cc2C#N)CC1 |
| InChI | InChI=1S/C14H19N3/c1-14(2)5-7-17(8-6-14)13-4-3-12(16)9-11(13)10-15/h3-4,9H,5-8,16H2,1-2H3 |
| InChIKey | IHQJIUZFTIWWSK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|