C15H21N3O — CID 102742837
5-amino-2-(2,2,6,6-tetramethylmorpholin-4-yl)benzonitrile (PubChem CID 102742837) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-amino-2-(2,2,6,6-tetramethylmorpholin-4-yl)benzonitrile.
| Compound Name | 5-amino-2-(2,2,6,6-tetramethylmorpholin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 102742837 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 5-amino-2-(2,2,6,6-tetramethylmorpholin-4-yl)benzonitrile |
| SMILES | CC1(C)CN(c2ccc(N)cc2C#N)CC(C)(C)O1 |
| InChI | InChI=1S/C15H21N3O/c1-14(2)9-18(10-15(3,4)19-14)13-6-5-12(17)7-11(13)8-16/h5-7H,9-10,17H2,1-4H3 |
| InChIKey | UEEKSQBKFUGPAJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|