C15H22N2O3 — CID 102745193
5-amino-2-(2,2,6,6-tetramethylmorpholin-4-yl)benzoic acid (PubChem CID 102745193) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 5-amino-2-(2,2,6,6-tetramethylmorpholin-4-yl)benzoic acid.
| Compound Name | 5-amino-2-(2,2,6,6-tetramethylmorpholin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 102745193 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 5-amino-2-(2,2,6,6-tetramethylmorpholin-4-yl)benzoic acid |
| SMILES | CC1(C)CN(c2ccc(N)cc2C(=O)O)CC(C)(C)O1 |
| InChI | InChI=1S/C15H22N2O3/c1-14(2)8-17(9-15(3,4)20-14)12-6-5-10(16)7-11(12)13(18)19/h5-7H,8-9,16H2,1-4H3,(H,18,19) |
| InChIKey | WKEUBFXBLWCEMI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|