C16H24N2O3 — CID 102742867
2-amino-3-methyl-5-(2,2,6,6-tetramethylmorpholin-4-yl)benzoic acid (PubChem CID 102742867) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-amino-3-methyl-5-(2,2,6,6-tetramethylmorpholin-4-yl)benzoic acid.
| Compound Name | 2-amino-3-methyl-5-(2,2,6,6-tetramethylmorpholin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 102742867 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-amino-3-methyl-5-(2,2,6,6-tetramethylmorpholin-4-yl)benzoic acid |
| SMILES | Cc1cc(N2CC(C)(C)OC(C)(C)C2)cc(C(=O)O)c1N |
| InChI | InChI=1S/C16H24N2O3/c1-10-6-11(7-12(13(10)17)14(19)20)18-8-15(2,3)21-16(4,5)9-18/h6-7H,8-9,17H2,1-5H3,(H,19,20) |
| InChIKey | IQPSBPNEHGZAOD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|