C13H18N4 — CID 61283993
5-amino-2-(4-methyl-1,4-diazepan-1-yl)benzonitrile (PubChem CID 61283993) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-amino-2-(4-methyl-1,4-diazepan-1-yl)benzonitrile.
| Compound Name | 5-amino-2-(4-methyl-1,4-diazepan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 61283993 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 5-amino-2-(4-methyl-1,4-diazepan-1-yl)benzonitrile |
| SMILES | CN1CCCN(c2ccc(N)cc2C#N)CC1 |
| InChI | InChI=1S/C13H18N4/c1-16-5-2-6-17(8-7-16)13-4-3-12(15)9-11(13)10-14/h3-4,9H,2,5-8,15H2,1H3 |
| InChIKey | XMDNUKQSGPONKN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|