C17H19F2N3 — CID 110452657
1-(2,4-difluorophenyl)-4-(1-pyridin-2-ylethyl)piperazine (PubChem CID 110452657) has the molecular formula C17H19F2N3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-4-(1-pyridin-2-ylethyl)piperazine.
| Compound Name | 1-(2,4-difluorophenyl)-4-(1-pyridin-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 110452657 |
| Molecular Formula | C17H19F2N3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-4-(1-pyridin-2-ylethyl)piperazine |
| SMILES | CC(c1ccccn1)N1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H19F2N3/c1-13(16-4-2-3-7-20-16)21-8-10-22(11-9-21)17-6-5-14(18)12-15(17)19/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | DRRPSQHEOQGIDE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |