C26H33FN4O — CID 89175328
2-[4-[4-[(1Z)-1-aminobuta-1,3-dienyl]-2-fluorophenyl]piperazin-1-yl]-N,N-diethyl-2-phenylacetamide (PubChem CID 89175328) has the molecular formula C26H33FN4O and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[4-[4-[(1Z)-1-aminobuta-1,3-dienyl]-2-fluorophenyl]piperazin-1-yl]-N,N-diethyl-2-phenylacetamide.
| Compound Name | 2-[4-[4-[(1Z)-1-aminobuta-1,3-dienyl]-2-fluorophenyl]piperazin-1-yl]-N,N-diethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 89175328 |
| Molecular Formula | C26H33FN4O |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 2-[4-[4-[(1Z)-1-aminobuta-1,3-dienyl]-2-fluorophenyl]piperazin-1-yl]-N,N-diethyl-2-phenylacetamide |
| SMILES | C=C/C=C(\N)c1ccc(N2CCN(C(C(=O)N(CC)CC)c3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H33FN4O/c1-4-10-23(28)21-13-14-24(22(27)19-21)30-15-17-31(18-16-30)25(20-11-8-7-9-12-20)26(32)29(5-2)6-3/h4,7-14,19,25H,1,5-6,15-18,28H2,2-3H3/b23-10- |
| InChIKey | JZNDWHNRSFNYLH-RMORIDSASA-N |
| XLogP | 4.04 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|