C23H28FN3O2 — CID 30776820
(2S)-N,N-diethyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-2-phenylacetamide (PubChem CID 30776820) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is (2S)-N,N-diethyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2S)-N,N-diethyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 30776820 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (2S)-N,N-diethyl-2-[4-(2-fluorobenzoyl)piperazin-1-yl]-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)[C@H](c1ccccc1)N1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H28FN3O2/c1-3-25(4-2)23(29)21(18-10-6-5-7-11-18)26-14-16-27(17-15-26)22(28)19-12-8-9-13-20(19)24/h5-13,21H,3-4,14-17H2,1-2H3/t21-/m0/s1 |
| InChIKey | MRSQQWUZOACRIH-NRFANRHFSA-N |
| XLogP | 3.19 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |