C39H37N3O2 — CID 20773851
N-[4-[4-(2-anilino-2-oxo-1-phenylethyl)piperidin-1-yl]phenyl]-2-benzylbenzamide (PubChem CID 20773851) has the molecular formula C39H37N3O2 and a molecular weight of 579.74 g/mol. Its IUPAC name is N-[4-[4-(2-anilino-2-oxo-1-phenylethyl)piperidin-1-yl]phenyl]-2-benzylbenzamide.
| Compound Name | N-[4-[4-(2-anilino-2-oxo-1-phenylethyl)piperidin-1-yl]phenyl]-2-benzylbenzamide |
|---|---|
| PubChem CID | 20773851 |
| Molecular Formula | C39H37N3O2 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | N-[4-[4-(2-anilino-2-oxo-1-phenylethyl)piperidin-1-yl]phenyl]-2-benzylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCC(C(C(=O)Nc3ccccc3)c3ccccc3)CC2)cc1)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C39H37N3O2/c43-38(36-19-11-10-16-32(36)28-29-12-4-1-5-13-29)40-34-20-22-35(23-21-34)42-26-24-31(25-27-42)37(30-14-6-2-7-15-30)39(44)41-33-17-8-3-9-18-33/h1-23,31,37H,24-28H2,(H,40,43)(H,41,44) |
| InChIKey | PSWZQIYIYYYJRP-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|