C26H28N2O — CID 19629747
N-[4-(4-methylpiperidin-1-yl)phenyl]-2,2-diphenylacetamide (PubChem CID 19629747) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 19629747 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)phenyl]-2,2-diphenylacetamide |
| SMILES | CC1CCN(c2ccc(NC(=O)C(c3ccccc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H28N2O/c1-20-16-18-28(19-17-20)24-14-12-23(13-15-24)27-26(29)25(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,20,25H,16-19H2,1H3,(H,27,29) |
| InChIKey | MAGZBAHWBXIGID-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|