C23H31N3O — CID 55914592
2-[4-(4-methylpiperidin-1-yl)anilino]-2-phenyl-N-propan-2-ylacetamide (PubChem CID 55914592) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-[4-(4-methylpiperidin-1-yl)anilino]-2-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-[4-(4-methylpiperidin-1-yl)anilino]-2-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55914592 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 2-[4-(4-methylpiperidin-1-yl)anilino]-2-phenyl-N-propan-2-ylacetamide |
| SMILES | CC1CCN(c2ccc(NC(C(=O)NC(C)C)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H31N3O/c1-17(2)24-23(27)22(19-7-5-4-6-8-19)25-20-9-11-21(12-10-20)26-15-13-18(3)14-16-26/h4-12,17-18,22,25H,13-16H2,1-3H3,(H,24,27) |
| InChIKey | OQEJYZKUSPDVSQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|