C40H39N3O3 — CID 142122709
N-[4-[4-[2-(benzylamino)-1-cyclohepta-1,3,6-trien-1-yl-2-oxoethyl]piperidin-1-yl]phenyl]-2-phenoxybenzamide (PubChem CID 142122709) has the molecular formula C40H39N3O3 and a molecular weight of 609.77 g/mol. Its IUPAC name is N-[4-[4-[2-(benzylamino)-1-cyclohepta-1,3,6-trien-1-yl-2-oxoethyl]piperidin-1-yl]phenyl]-2-phenoxybenzamide.
| Compound Name | N-[4-[4-[2-(benzylamino)-1-cyclohepta-1,3,6-trien-1-yl-2-oxoethyl]piperidin-1-yl]phenyl]-2-phenoxybenzamide |
|---|---|
| PubChem CID | 142122709 |
| Molecular Formula | C40H39N3O3 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | N-[4-[4-[2-(benzylamino)-1-cyclohepta-1,3,6-trien-1-yl-2-oxoethyl]piperidin-1-yl]phenyl]-2-phenoxybenzamide |
| SMILES | O=C(Nc1ccc(N2CCC(C(C(=O)NCc3ccccc3)C3=CC=CCC=C3)CC2)cc1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C40H39N3O3/c44-39(36-19-11-12-20-37(36)46-35-17-9-4-10-18-35)42-33-21-23-34(24-22-33)43-27-25-32(26-28-43)38(31-15-7-1-2-8-16-31)40(45)41-29-30-13-5-3-6-14-30/h1,3-24,32,38H,2,25-29H2,(H,41,45)(H,42,44) |
| InChIKey | HYECUMLZNVUSKE-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|