C35H38F3N3O4 — CID 11192887
ethyl 1-[2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]piperidine-2-carboxylate (PubChem CID 11192887) has the molecular formula C35H38F3N3O4 and a molecular weight of 621.70 g/mol. Its IUPAC name is ethyl 1-[2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 11192887 |
| Molecular Formula | C35H38F3N3O4 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | ethyl 1-[2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)CC1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C35H38F3N3O4/c1-2-45-34(44)31-9-5-6-20-41(31)32(42)23-24-18-21-40(22-19-24)28-16-14-27(15-17-28)39-33(43)30-8-4-3-7-29(30)25-10-12-26(13-11-25)35(36,37)38/h3-4,7-8,10-17,24,31H,2,5-6,9,18-23H2,1H3,(H,39,43) |
| InChIKey | MITMWOFBELWKOL-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|