C32H34F3N3O4 — CID 143062875
ethyl 2-[[2-[1-[4-[[2-oxo-1-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]amino]phenyl]piperidin-4-yl]acetyl]amino]acetate (PubChem CID 143062875) has the molecular formula C32H34F3N3O4 and a molecular weight of 581.64 g/mol. Its IUPAC name is ethyl 2-[[2-[1-[4-[[2-oxo-1-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]amino]phenyl]piperidin-4-yl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[1-[4-[[2-oxo-1-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]amino]phenyl]piperidin-4-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 143062875 |
| Molecular Formula | C32H34F3N3O4 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | ethyl 2-[[2-[1-[4-[[2-oxo-1-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]amino]phenyl]piperidin-4-yl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CC1CCN(c2ccc(NC(C=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H34F3N3O4/c1-2-42-31(41)20-36-30(40)19-22-15-17-38(18-16-22)26-13-11-25(12-14-26)37-29(21-39)28-6-4-3-5-27(28)23-7-9-24(10-8-23)32(33,34)35/h3-14,21-22,29,37H,2,15-20H2,1H3,(H,36,40) |
| InChIKey | YQCGGLSUKUXLDC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|