C21H24F3N3O — CID 109009809
2-[4-(4-methylpiperidin-1-yl)anilino]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 109009809) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is 2-[4-(4-methylpiperidin-1-yl)anilino]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-methylpiperidin-1-yl)anilino]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 109009809 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[4-(4-methylpiperidin-1-yl)anilino]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1CCN(c2ccc(NCC(=O)Nc3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H24F3N3O/c1-15-10-12-27(13-11-15)19-8-6-17(7-9-19)25-14-20(28)26-18-4-2-16(3-5-18)21(22,23)24/h2-9,15,25H,10-14H2,1H3,(H,26,28) |
| InChIKey | BDNILIXFVOOBJP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|