C20H23Cl2N3O — CID 109010555
N-(2,4-dichlorophenyl)-2-[4-(4-methylpiperidin-1-yl)anilino]acetamide (PubChem CID 109010555) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[4-(4-methylpiperidin-1-yl)anilino]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[4-(4-methylpiperidin-1-yl)anilino]acetamide |
|---|---|
| PubChem CID | 109010555 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[4-(4-methylpiperidin-1-yl)anilino]acetamide |
| SMILES | CC1CCN(c2ccc(NCC(=O)Nc3ccc(Cl)cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C20H23Cl2N3O/c1-14-8-10-25(11-9-14)17-5-3-16(4-6-17)23-13-20(26)24-19-7-2-15(21)12-18(19)22/h2-7,12,14,23H,8-11,13H2,1H3,(H,24,26) |
| InChIKey | WUUWJDJGXKMQPN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|