C17H24F3NO — CID 142379007
ethane;1-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propan-2-one (PubChem CID 142379007) has the molecular formula C17H24F3NO and a molecular weight of 315.38 g/mol. Its IUPAC name is ethane;1-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propan-2-one.
| Compound Name | ethane;1-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propan-2-one |
|---|---|
| PubChem CID | 142379007 |
| Molecular Formula | C17H24F3NO |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | ethane;1-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propan-2-one |
| SMILES | CC.CC(=O)CC1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H18F3NO.C2H6/c1-11(20)10-12-6-8-19(9-7-12)14-4-2-13(3-5-14)15(16,17)18;1-2/h2-5,12H,6-10H2,1H3;1-2H3 |
| InChIKey | ASQHNJJXYHLOMU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |