2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid

C10H15N3O4S — CID 116814510

IUPAC2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid
SMILESCn1cc(C(C(=O)O)N2CCCCS2(=O)=O)cn1
InChIInChI=1S/C10H15N3O4S/c1-12-7-8(6-11-12)9(10(14)15)13-4-2-3-5-18(13,16)17/h6-7,9H,2-5H2,1H3,(H,14,15)
InChIKeyGRIZHRGLPNERED-UHFFFAOYSA-N
MW273.31 g/mol
LogP-0.03
Rot. Bonds3

About 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid

2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid (PubChem CID 116814510) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid
PubChem CID116814510
Molecular FormulaC10H15N3O4S
Molecular Weight273.31 g/mol
Exact Mass273.08
IUPAC Name2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid
SMILESCn1cc(C(C(=O)O)N2CCCCS2(=O)=O)cn1
InChIInChI=1S/C10H15N3O4S/c1-12-7-8(6-11-12)9(10(14)15)13-4-2-3-5-18(13,16)17/h6-7,9H,2-5H2,1H3,(H,14,15)
InChIKeyGRIZHRGLPNERED-UHFFFAOYSA-N
XLogP-0.03
TPSA92.50 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.31
LogP ≤ 5-0.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid?
The IUPAC name of 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid (CID 116814510) is 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid.
What is the SMILES notation for 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid?
The canonical SMILES for 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid is Cn1cc(C(C(=O)O)N2CCCCS2(=O)=O)cn1.
What is the InChIKey of 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid?
The InChIKey is GRIZHRGLPNERED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4S/c1-12-7-8(6-11-12)9(10(14)15)13-4-2-3-5-18(13,16)17/h6-7,9H,2-5H2,1H3,(H,14,15).
What are the key properties of 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid?
2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid has a molecular weight of 273.31 g/mol, XLogP of -0.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiazinan-2-yl)-2-(1-methylpyrazol-4-yl)acetic acid is sourced from PubChem (CID 116814510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).