C15H17NO3 — CID 107861517
1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 107861517) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 107861517 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N([C@@H](CO)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C15H17NO3/c1-10-11(2)15(19)16(14(10)18)13(9-17)8-12-6-4-3-5-7-12/h3-7,13,17H,8-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | PYPVEVBBXUNAQK-CYBMUJFWSA-N |
| XLogP | 1.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|