C16H16 — CID 142307005
5-benzyl-2,3-dihydro-1H-indene (PubChem CID 142307005) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-benzyl-2,3-dihydro-1H-indene.
| Compound Name | 5-benzyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 142307005 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5-benzyl-2,3-dihydro-1H-indene |
| SMILES | c1ccc(Cc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C16H16/c1-2-5-13(6-3-1)11-14-9-10-15-7-4-8-16(15)12-14/h1-3,5-6,9-10,12H,4,7-8,11H2 |
| InChIKey | GPBHQTNHTKCRCN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |