C22H28 — CID 143940802
3-(8-phenyloctyl)bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 143940802) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 3-(8-phenyloctyl)bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-(8-phenyloctyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 143940802 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-(8-phenyloctyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | c1ccc(CCCCCCCCc2ccc3c(c2)CC3)cc1 |
| InChI | InChI=1S/C22H28/c1(3-6-10-19-11-8-5-9-12-19)2-4-7-13-20-14-15-21-16-17-22(21)18-20/h5,8-9,11-12,14-15,18H,1-4,6-7,10,13,16-17H2 |
| InChIKey | PKDBCXTUDSHFGX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|