C23H30 — CID 58151344
3-[8-(3-methylphenyl)octyl]bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 58151344) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is 3-[8-(3-methylphenyl)octyl]bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-[8-(3-methylphenyl)octyl]bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 58151344 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 3-[8-(3-methylphenyl)octyl]bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | Cc1cccc(CCCCCCCCc2ccc3c(c2)CC3)c1 |
| InChI | InChI=1S/C23H30/c1-19-9-8-12-20(17-19)10-6-4-2-3-5-7-11-21-13-14-22-15-16-23(22)18-21/h8-9,12-14,17-18H,2-7,10-11,15-16H2,1H3 |
| InChIKey | ZQMPTBKCZMPTKN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|