C49H66 — CID 159227161
1-butyl-3-ethenylbenzene;1-ethenyl-3-hexylbenzene;1-ethenyl-3-methylbenzene;3-hexylbicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 159227161) has the molecular formula C49H66 and a molecular weight of 655.07 g/mol. Its IUPAC name is 1-butyl-3-ethenylbenzene;1-ethenyl-3-hexylbenzene;1-ethenyl-3-methylbenzene;3-hexylbicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 1-butyl-3-ethenylbenzene;1-ethenyl-3-hexylbenzene;1-ethenyl-3-methylbenzene;3-hexylbicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 159227161 |
| Molecular Formula | C49H66 |
| Molecular Weight | 655.07 g/mol |
| Exact Mass | 654.52 |
| IUPAC Name | 1-butyl-3-ethenylbenzene;1-ethenyl-3-hexylbenzene;1-ethenyl-3-methylbenzene;3-hexylbicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | C=Cc1cccc(C)c1.C=Cc1cccc(CCCC)c1.C=Cc1cccc(CCCCCC)c1.CCCCCCc1ccc2c(c1)CC2 |
| InChI | InChI=1S/2C14H20.C12H16.C9H10/c1-2-3-4-5-6-12-7-8-13-9-10-14(13)11-12;1-3-5-6-7-9-14-11-8-10-13(4-2)12-14;1-3-5-7-12-9-6-8-11(4-2)10-12;1-3-9-6-4-5-8(2)7-9/h7-8,11H,2-6,9-10H2,1H3;4,8,10-12H,2-3,5-7,9H2,1H3;4,6,8-10H,2-3,5,7H2,1H3;3-7H,1H2,2H3 |
| InChIKey | KSKYOFQUCRPGBB-UHFFFAOYSA-N |
| XLogP | 14.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.07 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|