C21H25NO — CID 84533264
N-[3-(3-methylphenyl)propyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 84533264) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[3-(3-methylphenyl)propyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[3-(3-methylphenyl)propyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 84533264 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[3-(3-methylphenyl)propyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | Cc1cccc(CCCNC(=O)c2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C21H25NO/c1-16-6-4-7-17(14-16)8-5-13-22-21(23)20-12-11-18-9-2-3-10-19(18)15-20/h4,6-7,11-12,14-15H,2-3,5,8-10,13H2,1H3,(H,22,23) |
| InChIKey | WMNIZVLDDRMQSS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|