C12H15B — CID 147061074
CID 147061074 (PubChem CID 147061074) has the molecular formula C12H15B and a molecular weight of 170.06 g/mol.
| Compound Name | CID 147061074 |
|---|---|
| PubChem CID | 147061074 |
| Molecular Formula | C12H15B |
| Molecular Weight | 170.06 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | — |
| SMILES | [B]CCCCc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C12H15B/c13-8-2-1-3-10-4-5-11-6-7-12(11)9-10/h4-5,9H,1-3,6-8H2 |
| InChIKey | IKZJRFICCYFYIV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.06 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|