C11H11N3S — CID 13433503
6-benzylsulfanyl-5-methyl-1,2,4-triazine (PubChem CID 13433503) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 6-benzylsulfanyl-5-methyl-1,2,4-triazine.
| Compound Name | 6-benzylsulfanyl-5-methyl-1,2,4-triazine |
|---|---|
| PubChem CID | 13433503 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 6-benzylsulfanyl-5-methyl-1,2,4-triazine |
| SMILES | Cc1ncnnc1SCc1ccccc1 |
| InChI | InChI=1S/C11H11N3S/c1-9-11(14-13-8-12-9)15-7-10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | RSXORMTWVUKSSZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |