C19H15N3S3 — CID 6406876
4,7-bis(benzylsulfanyl)-[1,3]thiazolo[4,5-d]pyridazine (PubChem CID 6406876) has the molecular formula C19H15N3S3 and a molecular weight of 381.55 g/mol. Its IUPAC name is 4,7-bis(benzylsulfanyl)-[1,3]thiazolo[4,5-d]pyridazine.
| Compound Name | 4,7-bis(benzylsulfanyl)-[1,3]thiazolo[4,5-d]pyridazine |
|---|---|
| PubChem CID | 6406876 |
| Molecular Formula | C19H15N3S3 |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 4,7-bis(benzylsulfanyl)-[1,3]thiazolo[4,5-d]pyridazine |
| SMILES | c1ccc(CSc2nnc(SCc3ccccc3)c3scnc23)cc1 |
| InChI | InChI=1S/C19H15N3S3/c1-3-7-14(8-4-1)11-23-18-16-17(25-13-20-16)19(22-21-18)24-12-15-9-5-2-6-10-15/h1-10,13H,11-12H2 |
| InChIKey | VFQXIGHLAQMKNT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |