C12H10N2S2 — CID 22631537
7-benzylsulfanylimidazo[5,1-b][1,3]thiazole (PubChem CID 22631537) has the molecular formula C12H10N2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 7-benzylsulfanylimidazo[5,1-b][1,3]thiazole.
| Compound Name | 7-benzylsulfanylimidazo[5,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 22631537 |
| Molecular Formula | C12H10N2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 7-benzylsulfanylimidazo[5,1-b][1,3]thiazole |
| SMILES | c1ccc(CSc2ncn3ccsc23)cc1 |
| InChI | InChI=1S/C12H10N2S2/c1-2-4-10(5-3-1)8-16-11-12-14(9-13-11)6-7-15-12/h1-7,9H,8H2 |
| InChIKey | WUFYDYDCSGZDSP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |