C16H14N2OS2 — CID 60604161
2-[(3-phenylmethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazole (PubChem CID 60604161) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-[(3-phenylmethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazole.
| Compound Name | 2-[(3-phenylmethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 60604161 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-[(3-phenylmethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazole |
| SMILES | c1ccc(COc2cccc(CSc3nncs3)c2)cc1 |
| InChI | InChI=1S/C16H14N2OS2/c1-2-5-13(6-3-1)10-19-15-8-4-7-14(9-15)11-20-16-18-17-12-21-16/h1-9,12H,10-11H2 |
| InChIKey | GQOCHWQDHBSLLK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |