C22H16Cl2N2S2 — CID 102309856
1,4-bis[(4-chlorophenyl)methylsulfanyl]phthalazine (PubChem CID 102309856) has the molecular formula C22H16Cl2N2S2 and a molecular weight of 443.42 g/mol. Its IUPAC name is 1,4-bis[(4-chlorophenyl)methylsulfanyl]phthalazine.
| Compound Name | 1,4-bis[(4-chlorophenyl)methylsulfanyl]phthalazine |
|---|---|
| PubChem CID | 102309856 |
| Molecular Formula | C22H16Cl2N2S2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 1,4-bis[(4-chlorophenyl)methylsulfanyl]phthalazine |
| SMILES | Clc1ccc(CSc2nnc(SCc3ccc(Cl)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H16Cl2N2S2/c23-17-9-5-15(6-10-17)13-27-21-19-3-1-2-4-20(19)22(26-25-21)28-14-16-7-11-18(24)12-8-16/h1-12H,13-14H2 |
| InChIKey | RRDINXJZDNURAK-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |