About (4-chlorophenyl)methyl thiohypochlorite
(4-chlorophenyl)methyl thiohypochlorite (PubChem CID 57103251) has the molecular formula C7H6Cl2S
and a molecular weight of 193.10 g/mol. Its IUPAC name is (4-chlorophenyl)methyl thiohypochlorite.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl thiohypochlorite |
| PubChem CID | 57103251 |
| Molecular Formula | C7H6Cl2S |
| Molecular Weight | 193.10 g/mol |
| Exact Mass | 191.96 |
| IUPAC Name | (4-chlorophenyl)methyl thiohypochlorite |
| SMILES | ClSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H6Cl2S/c8-7-3-1-6(2-4-7)5-10-9/h1-4H,5H2 |
| InChIKey | DXHWGZAGFLJIKN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.10 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-chlorophenyl)methyl thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl thiohypochlorite?
The IUPAC name of (4-chlorophenyl)methyl thiohypochlorite (CID 57103251) is (4-chlorophenyl)methyl thiohypochlorite.
What is the SMILES notation for (4-chlorophenyl)methyl thiohypochlorite?
The canonical SMILES for (4-chlorophenyl)methyl thiohypochlorite is ClSCc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)methyl thiohypochlorite?
The InChIKey is DXHWGZAGFLJIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2S/c8-7-3-1-6(2-4-7)5-10-9/h1-4H,5H2.
What are the key properties of (4-chlorophenyl)methyl thiohypochlorite?
(4-chlorophenyl)methyl thiohypochlorite has a molecular weight of 193.10 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl thiohypochlorite is sourced from PubChem (CID 57103251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).