C9H6Cl4OS — CID 11141226
S-[(4-chlorophenyl)methyl] 2,2,2-trichloroethanethioate (PubChem CID 11141226) has the molecular formula C9H6Cl4OS and a molecular weight of 304.03 g/mol. Its IUPAC name is S-[(4-chlorophenyl)methyl] 2,2,2-trichloroethanethioate.
| Compound Name | S-[(4-chlorophenyl)methyl] 2,2,2-trichloroethanethioate |
|---|---|
| PubChem CID | 11141226 |
| Molecular Formula | C9H6Cl4OS |
| Molecular Weight | 304.03 g/mol |
| Exact Mass | 301.89 |
| IUPAC Name | S-[(4-chlorophenyl)methyl] 2,2,2-trichloroethanethioate |
| SMILES | O=C(SCc1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H6Cl4OS/c10-7-3-1-6(2-4-7)5-15-8(14)9(11,12)13/h1-4H,5H2 |
| InChIKey | HNYCZRNUMWKVFK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.03 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|