C22H14Cl4OS — CID 68542473
1-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-3-(2,3-dichlorophenyl)prop-2-en-1-one (PubChem CID 68542473) has the molecular formula C22H14Cl4OS and a molecular weight of 468.23 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-3-(2,3-dichlorophenyl)prop-2-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-3-(2,3-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68542473 |
| Molecular Formula | C22H14Cl4OS |
| Molecular Weight | 468.23 g/mol |
| Exact Mass | 465.95 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-3-(2,3-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(C(=Cc1cccc(Cl)c1Cl)SCc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14Cl4OS/c23-17-8-4-14(5-9-17)13-28-20(12-16-2-1-3-19(25)21(16)26)22(27)15-6-10-18(24)11-7-15/h1-12H,13H2 |
| InChIKey | VLGLSFOQIGMQKG-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.23 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|