C24H21BrClNOS — CID 52943398
(E)-1-(4-bromophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-3-[4-(dimethylamino)phenyl]prop-2-en-1-one (PubChem CID 52943398) has the molecular formula C24H21BrClNOS and a molecular weight of 486.86 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-3-[4-(dimethylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 52943398 |
| Molecular Formula | C24H21BrClNOS |
| Molecular Weight | 486.86 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | (E)-1-(4-bromophenyl)-2-[(4-chlorophenyl)methylsulfanyl]-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
| SMILES | CN(C)c1ccc(/C=C(/SCc2ccc(Cl)cc2)C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H21BrClNOS/c1-27(2)22-13-5-17(6-14-22)15-23(24(28)19-7-9-20(25)10-8-19)29-16-18-3-11-21(26)12-4-18/h3-15H,16H2,1-2H3/b23-15+ |
| InChIKey | VJYJQMFQSVSNMT-HZHRSRAPSA-N |
| XLogP | 7.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.86 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|