C22H16BrClOS — CID 24962921
(E)-1-(4-bromophenyl)-3-(4-chlorophenyl)-2-(4-methylphenyl)sulfanylprop-2-en-1-one (PubChem CID 24962921) has the molecular formula C22H16BrClOS and a molecular weight of 443.79 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-(4-chlorophenyl)-2-(4-methylphenyl)sulfanylprop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-(4-chlorophenyl)-2-(4-methylphenyl)sulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 24962921 |
| Molecular Formula | C22H16BrClOS |
| Molecular Weight | 443.79 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-(4-chlorophenyl)-2-(4-methylphenyl)sulfanylprop-2-en-1-one |
| SMILES | Cc1ccc(S/C(=C/c2ccc(Cl)cc2)C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H16BrClOS/c1-15-2-12-20(13-3-15)26-21(14-16-4-10-19(24)11-5-16)22(25)17-6-8-18(23)9-7-17/h2-14H,1H3/b21-14+ |
| InChIKey | NNXBYPNGIROHNO-KGENOOAVSA-N |
| XLogP | 7.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.79 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|