C23H18BrFOS — CID 24957805
(E)-1-(4-bromophenyl)-3-(4-fluoro-3-methylphenyl)-2-(4-methylphenyl)sulfanylprop-2-en-1-one (PubChem CID 24957805) has the molecular formula C23H18BrFOS and a molecular weight of 441.37 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-(4-fluoro-3-methylphenyl)-2-(4-methylphenyl)sulfanylprop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-(4-fluoro-3-methylphenyl)-2-(4-methylphenyl)sulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 24957805 |
| Molecular Formula | C23H18BrFOS |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-(4-fluoro-3-methylphenyl)-2-(4-methylphenyl)sulfanylprop-2-en-1-one |
| SMILES | Cc1ccc(S/C(=C/c2ccc(F)c(C)c2)C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H18BrFOS/c1-15-3-10-20(11-4-15)27-22(14-17-5-12-21(25)16(2)13-17)23(26)18-6-8-19(24)9-7-18/h3-14H,1-2H3/b22-14+ |
| InChIKey | NZOKLTVTLNSHHC-HYARGMPZSA-N |
| XLogP | 7.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|