C24H20BrFOS — CID 52942187
(E)-1-(4-bromophenyl)-3-(3,5-dimethylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]prop-2-en-1-one (PubChem CID 52942187) has the molecular formula C24H20BrFOS and a molecular weight of 455.39 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-(3,5-dimethylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-(3,5-dimethylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 52942187 |
| Molecular Formula | C24H20BrFOS |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-(3,5-dimethylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]prop-2-en-1-one |
| SMILES | Cc1cc(C)cc(/C=C(/SCc2ccc(F)cc2)C(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C24H20BrFOS/c1-16-11-17(2)13-19(12-16)14-23(24(27)20-5-7-21(25)8-6-20)28-15-18-3-9-22(26)10-4-18/h3-14H,15H2,1-2H3/b23-14+ |
| InChIKey | ZZEJJWIDVOLJDH-OEAKJJBVSA-N |
| XLogP | 7.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|