C23H15BrFNO5S — CID 52949498
4-[(E)-2-[(4-bromophenyl)methylsulfanyl]-3-(3-fluoro-4-nitrophenyl)prop-2-enoyl]benzoic acid (PubChem CID 52949498) has the molecular formula C23H15BrFNO5S and a molecular weight of 516.34 g/mol. Its IUPAC name is 4-[(E)-2-[(4-bromophenyl)methylsulfanyl]-3-(3-fluoro-4-nitrophenyl)prop-2-enoyl]benzoic acid.
| Compound Name | 4-[(E)-2-[(4-bromophenyl)methylsulfanyl]-3-(3-fluoro-4-nitrophenyl)prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 52949498 |
| Molecular Formula | C23H15BrFNO5S |
| Molecular Weight | 516.34 g/mol |
| Exact Mass | 514.98 |
| IUPAC Name | 4-[(E)-2-[(4-bromophenyl)methylsulfanyl]-3-(3-fluoro-4-nitrophenyl)prop-2-enoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)/C(=C\c2ccc([N+](=O)[O-])c(F)c2)SCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H15BrFNO5S/c24-18-8-1-14(2-9-18)13-32-21(12-15-3-10-20(26(30)31)19(25)11-15)22(27)16-4-6-17(7-5-16)23(28)29/h1-12H,13H2,(H,28,29)/b21-12+ |
| InChIKey | FIQGSMLCAHEYSC-CIAFOILYSA-N |
| XLogP | 6.35 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.34 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|