C23H15BrClNO7S — CID 52944627
4-[(E)-2-[(4-bromophenyl)methylsulfonyl]-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]benzoic acid (PubChem CID 52944627) has the molecular formula C23H15BrClNO7S and a molecular weight of 564.80 g/mol. Its IUPAC name is 4-[(E)-2-[(4-bromophenyl)methylsulfonyl]-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]benzoic acid.
| Compound Name | 4-[(E)-2-[(4-bromophenyl)methylsulfonyl]-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 52944627 |
| Molecular Formula | C23H15BrClNO7S |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 562.94 |
| IUPAC Name | 4-[(E)-2-[(4-bromophenyl)methylsulfonyl]-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)/C(=C\c2ccc(Cl)c([N+](=O)[O-])c2)S(=O)(=O)Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H15BrClNO7S/c24-18-8-1-14(2-9-18)13-34(32,33)21(12-15-3-10-19(25)20(11-15)26(30)31)22(27)16-4-6-17(7-5-16)23(28)29/h1-12H,13H2,(H,28,29)/b21-12+ |
| InChIKey | YDUITYVCCZLBSC-CIAFOILYSA-N |
| XLogP | 5.55 |
| TPSA | 131.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|