C16H11ClN2O5S — CID 68947098
(Z)-2-[(4-chlorophenyl)methylsulfonyl]-3-(4-hydroxy-3-nitrophenyl)prop-2-enenitrile (PubChem CID 68947098) has the molecular formula C16H11ClN2O5S and a molecular weight of 378.79 g/mol. Its IUPAC name is (Z)-2-[(4-chlorophenyl)methylsulfonyl]-3-(4-hydroxy-3-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[(4-chlorophenyl)methylsulfonyl]-3-(4-hydroxy-3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68947098 |
| Molecular Formula | C16H11ClN2O5S |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | (Z)-2-[(4-chlorophenyl)methylsulfonyl]-3-(4-hydroxy-3-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(O)c([N+](=O)[O-])c1)S(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClN2O5S/c17-13-4-1-11(2-5-13)10-25(23,24)14(9-18)7-12-3-6-16(20)15(8-12)19(21)22/h1-8,20H,10H2/b14-7- |
| InChIKey | ZPMYIILBSBXJNL-AUWJEWJLSA-N |
| XLogP | 3.43 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|