C22H15Br2NO6S — CID 68542482
1-(4-bromophenyl)-2-[(4-bromophenyl)methylsulfonyl]-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one (PubChem CID 68542482) has the molecular formula C22H15Br2NO6S and a molecular weight of 581.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[(4-bromophenyl)methylsulfonyl]-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-2-[(4-bromophenyl)methylsulfonyl]-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68542482 |
| Molecular Formula | C22H15Br2NO6S |
| Molecular Weight | 581.24 g/mol |
| Exact Mass | 578.90 |
| IUPAC Name | 1-(4-bromophenyl)-2-[(4-bromophenyl)methylsulfonyl]-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C(=Cc1ccc(O)c([N+](=O)[O-])c1)S(=O)(=O)Cc1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H15Br2NO6S/c23-17-6-1-14(2-7-17)13-32(30,31)21(22(27)16-4-8-18(24)9-5-16)12-15-3-10-20(26)19(11-15)25(28)29/h1-12,26H,13H2 |
| InChIKey | NFJZLWOIYSGZKY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.24 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|